![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 電車男 | 08-Sep-2006 03:16 | 1.3K | |
![[ ]](/icons/unknown.gif) | Adding methods at runtime.pod | 11-Feb-2008 15:27 | 5.5K | |
![[ ]](/icons/unknown.gif) | Adding more methods.pod | 02-Apr-2008 10:51 | 2.6K | |
![[ ]](/icons/unknown.gif) | Amazon Prime One Day Shipping Isn't.pod | 16-May-2009 00:16 | 3.5K | |
![[ ]](/icons/unknown.gif) | Angerwhale.pod | 08-Jul-2006 16:05 | 297 | |
![[DIR]](/icons/folder.gif) | Angerwhale/ | 04-Mar-2009 08:32 | - | |
![[ ]](/icons/unknown.gif) | Angerwhale 0.03 Released.pod | 14-Feb-2007 06:37 | 691 | |
![[ ]](/icons/unknown.gif) | Angerwhale 0.04 Released.pod | 12-Apr-2007 20:22 | 5.0K | |
![[ ]](/icons/unknown.gif) | Angerwhale 0.06 Released.pod | 18-Sep-2007 06:19 | 1.9K | |
![[ ]](/icons/unknown.gif) | Angerwhale 0.061 Released.pod | 19-Sep-2007 09:58 | 273 | |
![[ ]](/icons/unknown.gif) | Angerwhale Released.pod | 12-Feb-2007 04:52 | 734 | |
![[TXT]](/icons/text.gif) | Angerwhale Speedups!.html | 29-Jan-2007 04:17 | 3.7K | |
![[ ]](/icons/unknown.gif) | App::Persistent.pod | 30-Jul-2009 02:01 | 12K | |
![[ ]](/icons/unknown.gif) | Best Practice: Page by Date.pod | 18-Aug-2006 16:54 | 1.6K | |
![[TXT]](/icons/text.gif) | CatBot.html | 20-Oct-2006 03:06 | 1.2K | |
![[ ]](/icons/unknown.gif) | Catalyst + Cache.pod | 09-Aug-2006 14:07 | 3.2K | |
![[DIR]](/icons/folder.gif) | Catalyst/ | 04-Mar-2009 08:32 | - | |
![[ ]](/icons/unknown.gif) | Catalyst::Model::XML::Feed Released.pod | 22-Aug-2006 17:49 | 1.8K | |
![[ ]](/icons/unknown.gif) | Catalyst::Plugin::LogWarnings | 16-Sep-2006 23:10 | 185 | |
![[TXT]](/icons/text.gif) | Catalyst Book.html | 16-Dec-2007 02:24 | 1.6K | |
![[ ]](/icons/unknown.gif) | Catalyst PDF | 18-Apr-2007 22:03 | 449 | |
![[ ]](/icons/unknown.gif) | Catalyst Redirects.pod | 04-Mar-2007 23:33 | 1.5K | |
![[ ]](/icons/unknown.gif) | Catalyst Tips: Part 1.pod | 10-Oct-2007 01:57 | 4.2K | |
![[ ]](/icons/unknown.gif) | Catalyst book code.pod | 23-Apr-2008 22:45 | 2.1K | |
![[ ]](/icons/unknown.gif) | Catalyst server aliases.pod | 28-Sep-2008 12:05 | 764 | |
![[ ]](/icons/unknown.gif) | Check your modules against 5.10.pod | 19-Dec-2007 02:56 | 3.2K | |
![[ ]](/icons/unknown.gif) | Code > Sleep | 14-Jul-2006 14:32 | 350 | |
![[ ]](/icons/unknown.gif) | Complain about code on your blog.pod | 17-Dec-2007 13:54 | 1.5K | |
![[ ]](/icons/unknown.gif) | Convincing you to do it wrong.pod | 02-Aug-2009 14:25 | 7.8K | |
![[ ]](/icons/unknown.gif) | DON'T DO THIS.pod | 10-Aug-2007 03:31 | 476 | |
![[ ]](/icons/unknown.gif) | Datafix scripts with DBIx::Class.pod | 14-Sep-2007 01:06 | 3.4K | |
![[TXT]](/icons/text.gif) | DeCSS 2.0.txt | 30-Apr-2007 19:23 | 687 | |
![[ ]](/icons/unknown.gif) | Devel::BeginLift.pod | 13-Dec-2007 19:19 | 1.6K | |
![[ ]](/icons/unknown.gif) | Domain-specific languages for domain-specific objects.pod | 16-Nov-2009 07:02 | 22K | |
![[ ]](/icons/unknown.gif) | Dude, stop wasting your time.pod | 16-Jun-2009 08:07 | 2.3K | |
![[ ]](/icons/unknown.gif) | Emacs and Perl 5.10.pod | 17-Jan-2008 22:19 | 2.2K | |
![[ ]](/icons/unknown.gif) | Eproject 1.5.pod | 29-May-2009 03:24 | 5.9K | |
![[ ]](/icons/unknown.gif) | Ernst, Angerwhale, the Future of Perl Web Frameworks, and Deleted Email.pod | 04-Mar-2009 08:35 | 12K | |
![[ ]](/icons/unknown.gif) | Error checking.pod | 27-Sep-2008 03:46 | 5.4K | |
![[TXT]](/icons/text.gif) | Fans.txt | 13-May-2007 20:10 | 453 | |
![[ ]](/icons/unknown.gif) | FireGPG | 12-Apr-2007 20:27 | 469 | |
![[ ]](/icons/unknown.gif) | First Post.pod | 07-Jul-2006 20:34 | 162 | |
![[ ]](/icons/unknown.gif) | Fuck the internal representation.pod | 02-Mar-2008 02:13 | 1.1K | |
![[ ]](/icons/unknown.gif) | Git merging by example.pod | 28-Apr-2008 13:01 | 12K | |
![[ ]](/icons/unknown.gif) | Good Advice!.wiki | 11-Jul-2006 03:27 | 449 | |
![[ ]](/icons/unknown.gif) | Good advice.pod | 26-Dec-2007 15:00 | 2.7K | |
![[ ]](/icons/unknown.gif) | Heat Death.pod | 03-Aug-2006 00:10 | 6.4K | |
![[ ]](/icons/unknown.gif) | I hate hates-software.pod | 06-Aug-2007 12:48 | 428 | |
![[ ]](/icons/unknown.gif) | Increment test counter.pod | 24-Aug-2007 01:08 | 1.9K | |
![[ ]](/icons/unknown.gif) | Installing dependencies.pod | 21-Jul-2008 01:47 | 2.5K | |
![[ ]](/icons/unknown.gif) | Introducing App::TemplateServer.pod | 17-Jan-2008 22:36 | 1.8K | |
![[ ]](/icons/unknown.gif) | Iterators in elisp.pod | 13-Dec-2007 05:43 | 1.9K | |
![[ ]](/icons/unknown.gif) | It lives!.pod | 30-Jan-2007 21:01 | 1.1K | |
![[ ]](/icons/unknown.gif) | Java's type system can't protect you from me.pod | 09-Dec-2008 01:13 | 3.8K | |
![[ ]](/icons/unknown.gif) | Learn Perl.pod | 12-Jul-2009 10:03 | 2.4K | |
![[ ]](/icons/unknown.gif) | Learning Emacs Lisp has paid off.pod | 09-Dec-2007 02:33 | 4.8K | |
![[TXT]](/icons/text.gif) | Lenovo Shipping Sucks.html | 04-Nov-2007 15:33 | 6.2K | |
![[ ]](/icons/unknown.gif) | Liskov, Reuse, Inheritance, and Roles.pod | 09-Dec-2008 06:44 | 8.0K | |
![[ ]](/icons/unknown.gif) | Lisp has no syntax.pod | 05-Dec-2007 23:11 | 1.1K | |
![[ ]](/icons/unknown.gif) | Macros are probably not necessary.pod | 13-Apr-2008 22:45 | 2.1K | |
![[ ]](/icons/unknown.gif) | Marriage and Object Databases.pod | 22-Nov-2008 07:53 | 13K | |
![[ ]](/icons/unknown.gif) | Matching socks.pod | 04-Jan-2008 14:54 | 1.2K | |
![[ ]](/icons/unknown.gif) | Memory Profiling part 1.pod | 09-Aug-2007 02:32 | 8.4K | |
![[ ]](/icons/unknown.gif) | Misleading Code.pod | 24-Nov-2007 23:27 | 1.1K | |
![[ ]](/icons/unknown.gif) | Mixing Class::C3 and NEXT.pod | 03-Sep-2007 03:42 | 2.6K | |
![[ ]](/icons/unknown.gif) | MooseX::Traits.pod | 14-Jul-2008 21:18 | 1.5K | |
![[TXT]](/icons/text.gif) | More IRC Fun.txt | 29-Jun-2007 01:29 | 1.0K | |
![[ ]](/icons/unknown.gif) | More cperl-mode enhancements.pod | 10-May-2009 16:42 | 2.4K | |
![[ ]](/icons/unknown.gif) | Moving to Github.pod | 09-Jan-2009 00:57 | 1.4K | |
![[ ]](/icons/unknown.gif) | Multimethods.pod | 26-Apr-2009 03:01 | 6.6K | |
![[ ]](/icons/unknown.gif) | My perl blog.pod | 01-May-2008 12:06 | 2.9K | |
![[ ]](/icons/unknown.gif) | Myth: Moose is an unnecessary dependency.pod | 26-Nov-2007 12:58 | 4.9K | |
![[TXT]](/icons/text.gif) | Network Solutions Sucks.html | 08-Jan-2008 21:25 | 904 | |
![[ ]](/icons/unknown.gif) | New Module: Algorithm::IncludeExclude.pod | 12-Feb-2007 05:01 | 1.7K | |
![[ ]](/icons/unknown.gif) | New Module: Test::YAML::Valid.pod | 01-Feb-2007 23:27 | 1.2K | |
![[ ]](/icons/unknown.gif) | New Modules.pod | 12-Oct-2006 04:39 | 1.0K | |
![[ ]](/icons/unknown.gif) | New ircxory features.pod | 13-Sep-2007 01:50 | 1.1K | |
![[ ]](/icons/unknown.gif) | New theme | 05-Sep-2006 03:38 | 692 | |
![[ ]](/icons/unknown.gif) | OpenBSD Ports | 10-Aug-2006 03:03 | 335 | |
![[ ]](/icons/unknown.gif) | Pannier update.pod | 17-Apr-2008 00:08 | 1.6K | |
![[ ]](/icons/unknown.gif) | Papers, please..markdown | 11-Mar-2007 04:00 | 1.1K | |
![[ ]](/icons/unknown.gif) | Perl 2.0.pod | 27-Jan-2009 13:25 | 663 | |
![[ ]](/icons/unknown.gif) | Plugging a leaky whale.pod | 30-Aug-2007 06:01 | 4.8K | |
![[ ]](/icons/unknown.gif) | Problems with Lisp.pod | 25-Jan-2009 23:41 | 5.9K | |
![[DIR]](/icons/folder.gif) | Programming/ | 29-May-2009 03:25 | - | |
![[ ]](/icons/unknown.gif) | Quantum Physics and the Template Toolkit.pod | 07-Aug-2006 05:44 | 2.6K | |
![[TXT]](/icons/text.gif) | RSS Feeds.html | 31-Jul-2006 03:40 | 249 | |
![[ ]](/icons/unknown.gif) | RSpec vs. Test::More.pod | 06-Feb-2008 17:19 | 4.8K | |
![[TXT]](/icons/text.gif) | Reading, not writing.html | 19-Aug-2007 01:55 | 761 | |
![[ ]](/icons/unknown.gif) | Real Perl Golf.pod | 01-Aug-2009 00:10 | 3.2K | |
![[ ]](/icons/unknown.gif) | Sanity check.pod | 23-Aug-2007 21:41 | 832 | |
![[ ]](/icons/unknown.gif) | Serial Number.pod | 08-Aug-2006 00:16 | 1.7K | |
![[ ]](/icons/unknown.gif) | Signing Works.pod | 12-Jul-2006 04:57 | 1.0K | |
![[ ]](/icons/unknown.gif) | Sorry about the Angerwhale bugs.pod | 02-Mar-2008 20:19 | 1.1K | |
![[TXT]](/icons/text.gif) | Spam is hilarious.html | 04-Dec-2006 01:15 | 3.2K | |
![[ ]](/icons/unknown.gif) | String::TT.pod | 08-May-2008 15:09 | 1.3K | |
![[ ]](/icons/unknown.gif) | Stylish REPL.pod | 02-Apr-2008 13:17 | 2.2K | |
![[ ]](/icons/unknown.gif) | Sue me.pod | 02-Apr-2008 10:13 | 1.3K | |
![[ ]](/icons/unknown.gif) | Superglobals.pod | 23-Jul-2006 02:29 | 5.0K | |
![[ ]](/icons/unknown.gif) | Syntax Highlighting.pod | 25-Jan-2007 20:54 | 1.4K | |
![[ ]](/icons/unknown.gif) | Syntax and features.pod | 05-Apr-2008 08:25 | 2.9K | |
![[ ]](/icons/unknown.gif) | Tea Balls | 05-Sep-2006 03:38 | 807 | |
![[ ]](/icons/unknown.gif) | Template::Refine.pod | 07-Sep-2008 05:59 | 11K | |
![[ ]](/icons/unknown.gif) | Text::EmacsColor.pod | 03-Dec-2008 03:14 | 2.6K | |
![[ ]](/icons/unknown.gif) | Tiny is broken.pod | 12-Sep-2007 02:32 | 1.9K | |
![[ ]](/icons/unknown.gif) | Trek grocery panniers.pod | 05-Apr-2008 17:29 | 5.2K | |
![[TXT]](/icons/text.gif) | Twitter.html | 21-Aug-2007 20:39 | 456 | |
![[TXT]](/icons/text.gif) | Uh, yeah....html | 04-Sep-2006 21:03 | 303 | |
![[ ]](/icons/unknown.gif) | Unshortening URLs with Modern Perl.pod | 06-Apr-2009 17:45 | 14K | |
![[ ]](/icons/unknown.gif) | Useless use of "useless use".pod | 07-Oct-2008 20:43 | 2.1K | |
![[TXT]](/icons/text.gif) | Video games.html | 08-Dec-2007 18:56 | 346 | |
![[ ]](/icons/unknown.gif) | Visualizing your DBIC schema.pod | 16-Oct-2007 00:21 | 876 | |
![[ ]](/icons/unknown.gif) | Void if sold.pod | 05-May-2008 15:00 | 822 | |
![[ ]](/icons/unknown.gif) | We do what we must.pod | 20-Jan-2008 03:59 | 608 | |
![[ ]](/icons/unknown.gif) | Weewar API for Perl.pod | 17-Sep-2007 00:46 | 1.5K | |
![[ ]](/icons/unknown.gif) | What I'm Up To.pod | 06-Aug-2007 03:52 | 8.1K | |
![[ ]](/icons/unknown.gif) | Why I hate non-Free software.pod | 10-Jun-2009 23:23 | 2.0K | |
![[ ]](/icons/unknown.gif) | Wow..pod | 13-Jul-2006 23:20 | 362 | |
![[ ]](/icons/unknown.gif) | You are missing the point of Perl.pod | 04-Aug-2008 11:59 | 10K | |
![[ ]](/icons/unknown.gif) | cperl-mode.el and Moose.pod | 11-Dec-2008 09:19 | 699 | |
![[ ]](/icons/unknown.gif) | eproject.pod | 10-Jun-2009 22:53 | 4.6K | |
![[ ]](/icons/unknown.gif) | purl is 100!.pod | 02-Sep-2007 00:47 | 1.5K | |
![[ ]](/icons/unknown.gif) | rcirc notifications in xmobar.pod | 24-Aug-2009 22:26 | 4.6K | |
![[ ]](/icons/unknown.gif) | the_function_class.pod | 21-Sep-2008 04:18 | 2.3K | |
![[ ]](/icons/unknown.gif) | urxvt + pwsafe.pod | 11-Jun-2009 02:38 | 2.8K | |
|